C23H26N2O6S — CID 84563545
4-O-ethyl 2-O-(2-methoxyethyl) 5-(3-indol-1-ylpropanoylamino)-3-methylthiophene-2,4-dicarboxylate (PubChem CID 84563545) has the molecular formula C23H26N2O6S and a molecular weight of 458.54 g/mol. Its IUPAC name is 4-O-ethyl 2-O-(2-methoxyethyl) 5-(3-indol-1-ylpropanoylamino)-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | 4-O-ethyl 2-O-(2-methoxyethyl) 5-(3-indol-1-ylpropanoylamino)-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 84563545 |
| Molecular Formula | C23H26N2O6S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 4-O-ethyl 2-O-(2-methoxyethyl) 5-(3-indol-1-ylpropanoylamino)-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CCn2ccc3ccccc32)sc(C(=O)OCCOC)c1C |
| InChI | InChI=1S/C23H26N2O6S/c1-4-30-22(27)19-15(2)20(23(28)31-14-13-29-3)32-21(19)24-18(26)10-12-25-11-9-16-7-5-6-8-17(16)25/h5-9,11H,4,10,12-14H2,1-3H3,(H,24,26) |
| InChIKey | LOENJDLYJLIRFH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|