C21H25NO8S — CID 26218292
4-O-ethyl 2-O-(2-methoxyethyl) 5-[[2-(2-methoxyphenoxy)acetyl]amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 26218292) has the molecular formula C21H25NO8S and a molecular weight of 451.50 g/mol. Its IUPAC name is 4-O-ethyl 2-O-(2-methoxyethyl) 5-[[2-(2-methoxyphenoxy)acetyl]amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | 4-O-ethyl 2-O-(2-methoxyethyl) 5-[[2-(2-methoxyphenoxy)acetyl]amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 26218292 |
| Molecular Formula | C21H25NO8S |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 4-O-ethyl 2-O-(2-methoxyethyl) 5-[[2-(2-methoxyphenoxy)acetyl]amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)COc2ccccc2OC)sc(C(=O)OCCOC)c1C |
| InChI | InChI=1S/C21H25NO8S/c1-5-28-20(24)17-13(2)18(21(25)29-11-10-26-3)31-19(17)22-16(23)12-30-15-9-7-6-8-14(15)27-4/h6-9H,5,10-12H2,1-4H3,(H,22,23) |
| InChIKey | NIWHROZHVFOISM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|