C16H23NO6S — CID 19172792
diethyl 5-(butoxycarbonylamino)-3-methylthiophene-2,4-dicarboxylate (PubChem CID 19172792) has the molecular formula C16H23NO6S and a molecular weight of 357.43 g/mol. Its IUPAC name is diethyl 5-(butoxycarbonylamino)-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-(butoxycarbonylamino)-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 19172792 |
| Molecular Formula | C16H23NO6S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | diethyl 5-(butoxycarbonylamino)-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCCCOC(=O)Nc1sc(C(=O)OCC)c(C)c1C(=O)OCC |
| InChI | InChI=1S/C16H23NO6S/c1-5-8-9-23-16(20)17-13-11(14(18)21-6-2)10(4)12(24-13)15(19)22-7-3/h5-9H2,1-4H3,(H,17,20) |
| InChIKey | YHYLLIXKKFBJCG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|