C15H21NO6S — CID 22053783
5-(heptoxycarbonylamino)-3-methylthiophene-2,4-dicarboxylic acid (PubChem CID 22053783) has the molecular formula C15H21NO6S and a molecular weight of 343.40 g/mol. Its IUPAC name is 5-(heptoxycarbonylamino)-3-methylthiophene-2,4-dicarboxylic acid.
| Compound Name | 5-(heptoxycarbonylamino)-3-methylthiophene-2,4-dicarboxylic acid |
|---|---|
| PubChem CID | 22053783 |
| Molecular Formula | C15H21NO6S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 5-(heptoxycarbonylamino)-3-methylthiophene-2,4-dicarboxylic acid |
| SMILES | CCCCCCCOC(=O)Nc1sc(C(=O)O)c(C)c1C(=O)O |
| InChI | InChI=1S/C15H21NO6S/c1-3-4-5-6-7-8-22-15(21)16-12-10(13(17)18)9(2)11(23-12)14(19)20/h3-8H2,1-2H3,(H,16,21)(H,17,18)(H,19,20) |
| InChIKey | MWJHFYZQSMDSRJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|