C21H33NO5S — CID 3123953
diethyl 5-(decanoylamino)-3-methylthiophene-2,4-dicarboxylate (PubChem CID 3123953) has the molecular formula C21H33NO5S and a molecular weight of 411.56 g/mol. Its IUPAC name is diethyl 5-(decanoylamino)-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-(decanoylamino)-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 3123953 |
| Molecular Formula | C21H33NO5S |
| Molecular Weight | 411.56 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | diethyl 5-(decanoylamino)-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCCCCCCCCC(=O)Nc1sc(C(=O)OCC)c(C)c1C(=O)OCC |
| InChI | InChI=1S/C21H33NO5S/c1-5-8-9-10-11-12-13-14-16(23)22-19-17(20(24)26-6-2)15(4)18(28-19)21(25)27-7-3/h5-14H2,1-4H3,(H,22,23) |
| InChIKey | SLAKPYLIYJYFKL-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.56 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|