C16H20ClNO5S — CID 4849876
4-O-ethyl 2-O-prop-2-enyl 5-(4-chlorobutanoylamino)-3-methylthiophene-2,4-dicarboxylate (PubChem CID 4849876) has the molecular formula C16H20ClNO5S and a molecular weight of 373.86 g/mol. Its IUPAC name is 4-O-ethyl 2-O-prop-2-enyl 5-(4-chlorobutanoylamino)-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | 4-O-ethyl 2-O-prop-2-enyl 5-(4-chlorobutanoylamino)-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 4849876 |
| Molecular Formula | C16H20ClNO5S |
| Molecular Weight | 373.86 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 4-O-ethyl 2-O-prop-2-enyl 5-(4-chlorobutanoylamino)-3-methylthiophene-2,4-dicarboxylate |
| SMILES | C=CCOC(=O)c1sc(NC(=O)CCCCl)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C16H20ClNO5S/c1-4-9-23-16(21)13-10(3)12(15(20)22-5-2)14(24-13)18-11(19)7-6-8-17/h4H,1,5-9H2,2-3H3,(H,18,19) |
| InChIKey | NGJHJNLUDPBAAC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.86 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|