C20H21FN2O5S — CID 9098956
4-O-ethyl 2-O-prop-2-enyl 5-[[2-(3-fluoroanilino)acetyl]amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 9098956) has the molecular formula C20H21FN2O5S and a molecular weight of 420.46 g/mol. Its IUPAC name is 4-O-ethyl 2-O-prop-2-enyl 5-[[2-(3-fluoroanilino)acetyl]amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | 4-O-ethyl 2-O-prop-2-enyl 5-[[2-(3-fluoroanilino)acetyl]amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 9098956 |
| Molecular Formula | C20H21FN2O5S |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 4-O-ethyl 2-O-prop-2-enyl 5-[[2-(3-fluoroanilino)acetyl]amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | C=CCOC(=O)c1sc(NC(=O)CNc2cccc(F)c2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C20H21FN2O5S/c1-4-9-28-20(26)17-12(3)16(19(25)27-5-2)18(29-17)23-15(24)11-22-14-8-6-7-13(21)10-14/h4,6-8,10,22H,1,5,9,11H2,2-3H3,(H,23,24) |
| InChIKey | QMRCWLHLESQHLC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|