C26H27N2O5S+ — CID 4830803
4-O-ethyl 2-O-prop-2-enyl 5-[[2-(4-benzylpyridin-1-ium-1-yl)acetyl]amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 4830803) has the molecular formula C26H27N2O5S+ and a molecular weight of 479.58 g/mol. Its IUPAC name is 4-O-ethyl 2-O-prop-2-enyl 5-[[2-(4-benzylpyridin-1-ium-1-yl)acetyl]amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | 4-O-ethyl 2-O-prop-2-enyl 5-[[2-(4-benzylpyridin-1-ium-1-yl)acetyl]amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 4830803 |
| Molecular Formula | C26H27N2O5S+ |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 4-O-ethyl 2-O-prop-2-enyl 5-[[2-(4-benzylpyridin-1-ium-1-yl)acetyl]amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | C=CCOC(=O)c1sc(NC(=O)C[n+]2ccc(Cc3ccccc3)cc2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C26H26N2O5S/c1-4-15-33-26(31)23-18(3)22(25(30)32-5-2)24(34-23)27-21(29)17-28-13-11-20(12-14-28)16-19-9-7-6-8-10-19/h4,6-14H,1,5,15-17H2,2-3H3/p+1 |
| InChIKey | GUZAMGHCRABFCZ-UHFFFAOYSA-O |
| XLogP | 4.09 |
| TPSA | 85.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|