C19H23N2O4S+ — CID 8857116
ethyl 5-acetyl-2-[[2-(4-ethylpyridin-1-ium-1-yl)acetyl]amino]-4-methylthiophene-3-carboxylate (PubChem CID 8857116) has the molecular formula C19H23N2O4S+ and a molecular weight of 375.47 g/mol. Its IUPAC name is ethyl 5-acetyl-2-[[2-(4-ethylpyridin-1-ium-1-yl)acetyl]amino]-4-methylthiophene-3-carboxylate.
| Compound Name | ethyl 5-acetyl-2-[[2-(4-ethylpyridin-1-ium-1-yl)acetyl]amino]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 8857116 |
| Molecular Formula | C19H23N2O4S+ |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | ethyl 5-acetyl-2-[[2-(4-ethylpyridin-1-ium-1-yl)acetyl]amino]-4-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C[n+]2ccc(CC)cc2)sc(C(C)=O)c1C |
| InChI | InChI=1S/C19H22N2O4S/c1-5-14-7-9-21(10-8-14)11-15(23)20-18-16(19(24)25-6-2)12(3)17(26-18)13(4)22/h7-10H,5-6,11H2,1-4H3/p+1 |
| InChIKey | DCDIQOUMXFCAAP-UHFFFAOYSA-O |
| XLogP | 2.92 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|