C15H19NO7S — CID 7775919
ethyl 5-acetyl-2-[[2-(2-methoxyacetyl)oxyacetyl]amino]-4-methylthiophene-3-carboxylate (PubChem CID 7775919) has the molecular formula C15H19NO7S and a molecular weight of 357.38 g/mol. Its IUPAC name is ethyl 5-acetyl-2-[[2-(2-methoxyacetyl)oxyacetyl]amino]-4-methylthiophene-3-carboxylate.
| Compound Name | ethyl 5-acetyl-2-[[2-(2-methoxyacetyl)oxyacetyl]amino]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 7775919 |
| Molecular Formula | C15H19NO7S |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | ethyl 5-acetyl-2-[[2-(2-methoxyacetyl)oxyacetyl]amino]-4-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)COC(=O)COC)sc(C(C)=O)c1C |
| InChI | InChI=1S/C15H19NO7S/c1-5-22-15(20)12-8(2)13(9(3)17)24-14(12)16-10(18)6-23-11(19)7-21-4/h5-7H2,1-4H3,(H,16,18) |
| InChIKey | KTMQKGKCLQJXAE-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |