C17H23NO6S — CID 2628944
ethyl 5-acetyl-4-methyl-2-[(2-pentanoyloxyacetyl)amino]thiophene-3-carboxylate (PubChem CID 2628944) has the molecular formula C17H23NO6S and a molecular weight of 369.44 g/mol. Its IUPAC name is ethyl 5-acetyl-4-methyl-2-[(2-pentanoyloxyacetyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-acetyl-4-methyl-2-[(2-pentanoyloxyacetyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2628944 |
| Molecular Formula | C17H23NO6S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | ethyl 5-acetyl-4-methyl-2-[(2-pentanoyloxyacetyl)amino]thiophene-3-carboxylate |
| SMILES | CCCCC(=O)OCC(=O)Nc1sc(C(C)=O)c(C)c1C(=O)OCC |
| InChI | InChI=1S/C17H23NO6S/c1-5-7-8-13(21)24-9-12(20)18-16-14(17(22)23-6-2)10(3)15(25-16)11(4)19/h5-9H2,1-4H3,(H,18,20) |
| InChIKey | FLSJTFWUSIRNQE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |