C23H27NO8S — CID 5123776
diethyl 3-methyl-5-[[2-(4-phenoxybutanoyloxy)acetyl]amino]thiophene-2,4-dicarboxylate (PubChem CID 5123776) has the molecular formula C23H27NO8S and a molecular weight of 477.54 g/mol. Its IUPAC name is diethyl 3-methyl-5-[[2-(4-phenoxybutanoyloxy)acetyl]amino]thiophene-2,4-dicarboxylate.
| Compound Name | diethyl 3-methyl-5-[[2-(4-phenoxybutanoyloxy)acetyl]amino]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 5123776 |
| Molecular Formula | C23H27NO8S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | diethyl 3-methyl-5-[[2-(4-phenoxybutanoyloxy)acetyl]amino]thiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)COC(=O)CCCOc2ccccc2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C23H27NO8S/c1-4-29-22(27)19-15(3)20(23(28)30-5-2)33-21(19)24-17(25)14-32-18(26)12-9-13-31-16-10-7-6-8-11-16/h6-8,10-11H,4-5,9,12-14H2,1-3H3,(H,24,25) |
| InChIKey | FEIUAPGQABIJHX-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|