C20H22N2O8S — CID 3425656
2-methoxyethyl 5-carbamoyl-4-methyl-2-[[2-(2-phenoxyacetyl)oxyacetyl]amino]thiophene-3-carboxylate (PubChem CID 3425656) has the molecular formula C20H22N2O8S and a molecular weight of 450.47 g/mol. Its IUPAC name is 2-methoxyethyl 5-carbamoyl-4-methyl-2-[[2-(2-phenoxyacetyl)oxyacetyl]amino]thiophene-3-carboxylate.
| Compound Name | 2-methoxyethyl 5-carbamoyl-4-methyl-2-[[2-(2-phenoxyacetyl)oxyacetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 3425656 |
| Molecular Formula | C20H22N2O8S |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 2-methoxyethyl 5-carbamoyl-4-methyl-2-[[2-(2-phenoxyacetyl)oxyacetyl]amino]thiophene-3-carboxylate |
| SMILES | COCCOC(=O)c1c(NC(=O)COC(=O)COc2ccccc2)sc(C(N)=O)c1C |
| InChI | InChI=1S/C20H22N2O8S/c1-12-16(20(26)28-9-8-27-2)19(31-17(12)18(21)25)22-14(23)10-30-15(24)11-29-13-6-4-3-5-7-13/h3-7H,8-11H2,1-2H3,(H2,21,25)(H,22,23) |
| InChIKey | LHEJHLPHQCSBDA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 143.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|