C22H25NO8S — CID 41466445
diethyl 3-methyl-5-[[2-[2-(3-methylphenoxy)acetyl]oxyacetyl]amino]thiophene-2,4-dicarboxylate (PubChem CID 41466445) has the molecular formula C22H25NO8S and a molecular weight of 463.51 g/mol. Its IUPAC name is diethyl 3-methyl-5-[[2-[2-(3-methylphenoxy)acetyl]oxyacetyl]amino]thiophene-2,4-dicarboxylate.
| Compound Name | diethyl 3-methyl-5-[[2-[2-(3-methylphenoxy)acetyl]oxyacetyl]amino]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 41466445 |
| Molecular Formula | C22H25NO8S |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | diethyl 3-methyl-5-[[2-[2-(3-methylphenoxy)acetyl]oxyacetyl]amino]thiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)COC(=O)COc2cccc(C)c2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C22H25NO8S/c1-5-28-21(26)18-14(4)19(22(27)29-6-2)32-20(18)23-16(24)11-31-17(25)12-30-15-9-7-8-13(3)10-15/h7-10H,5-6,11-12H2,1-4H3,(H,23,24) |
| InChIKey | YHABUWANPRDEIK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|