C22H23NO9S — CID 16506471
diethyl 5-[[2-(4-methoxycarbonylbenzoyl)oxyacetyl]amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 16506471) has the molecular formula C22H23NO9S and a molecular weight of 477.49 g/mol. Its IUPAC name is diethyl 5-[[2-(4-methoxycarbonylbenzoyl)oxyacetyl]amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-[[2-(4-methoxycarbonylbenzoyl)oxyacetyl]amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 16506471 |
| Molecular Formula | C22H23NO9S |
| Molecular Weight | 477.49 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | diethyl 5-[[2-(4-methoxycarbonylbenzoyl)oxyacetyl]amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)COC(=O)c2ccc(C(=O)OC)cc2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C22H23NO9S/c1-5-30-21(27)16-12(3)17(22(28)31-6-2)33-18(16)23-15(24)11-32-20(26)14-9-7-13(8-10-14)19(25)29-4/h7-10H,5-6,11H2,1-4H3,(H,23,24) |
| InChIKey | IQIFBDLLRKBWFI-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.49 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|