C19H19BrN2O7S — CID 2680713
diethyl 5-[[2-(5-bromopyridine-3-carbonyl)oxyacetyl]amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 2680713) has the molecular formula C19H19BrN2O7S and a molecular weight of 499.34 g/mol. Its IUPAC name is diethyl 5-[[2-(5-bromopyridine-3-carbonyl)oxyacetyl]amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-[[2-(5-bromopyridine-3-carbonyl)oxyacetyl]amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 2680713 |
| Molecular Formula | C19H19BrN2O7S |
| Molecular Weight | 499.34 g/mol |
| Exact Mass | 498.01 |
| IUPAC Name | diethyl 5-[[2-(5-bromopyridine-3-carbonyl)oxyacetyl]amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)COC(=O)c2cncc(Br)c2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C19H19BrN2O7S/c1-4-27-18(25)14-10(3)15(19(26)28-5-2)30-16(14)22-13(23)9-29-17(24)11-6-12(20)8-21-7-11/h6-8H,4-5,9H2,1-3H3,(H,22,23) |
| InChIKey | QAUZMAGEBMZSOV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 120.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|