C22H24N2O8S — CID 16520809
diethyl 5-[[2-(4-acetamidobenzoyl)oxyacetyl]amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 16520809) has the molecular formula C22H24N2O8S and a molecular weight of 476.51 g/mol. Its IUPAC name is diethyl 5-[[2-(4-acetamidobenzoyl)oxyacetyl]amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-[[2-(4-acetamidobenzoyl)oxyacetyl]amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 16520809 |
| Molecular Formula | C22H24N2O8S |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | diethyl 5-[[2-(4-acetamidobenzoyl)oxyacetyl]amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)COC(=O)c2ccc(NC(C)=O)cc2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C22H24N2O8S/c1-5-30-21(28)17-12(3)18(22(29)31-6-2)33-19(17)24-16(26)11-32-20(27)14-7-9-15(10-8-14)23-13(4)25/h7-10H,5-6,11H2,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | MFKSPGHNJPAXBR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|