C20H21NO6S — CID 2506323
ethyl 5-acetyl-4-methyl-2-[[2-(4-methylbenzoyl)oxyacetyl]amino]thiophene-3-carboxylate (PubChem CID 2506323) has the molecular formula C20H21NO6S and a molecular weight of 403.46 g/mol. Its IUPAC name is ethyl 5-acetyl-4-methyl-2-[[2-(4-methylbenzoyl)oxyacetyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-acetyl-4-methyl-2-[[2-(4-methylbenzoyl)oxyacetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2506323 |
| Molecular Formula | C20H21NO6S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | ethyl 5-acetyl-4-methyl-2-[[2-(4-methylbenzoyl)oxyacetyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)COC(=O)c2ccc(C)cc2)sc(C(C)=O)c1C |
| InChI | InChI=1S/C20H21NO6S/c1-5-26-20(25)16-12(3)17(13(4)22)28-18(16)21-15(23)10-27-19(24)14-8-6-11(2)7-9-14/h6-9H,5,10H2,1-4H3,(H,21,23) |
| InChIKey | IVWRUVCDSNXKKL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |