C19H21NO7S2 — CID 3984044
diethyl 3-methyl-5-[[2-(5-methylthiophene-2-carbonyl)oxyacetyl]amino]thiophene-2,4-dicarboxylate (PubChem CID 3984044) has the molecular formula C19H21NO7S2 and a molecular weight of 439.51 g/mol. Its IUPAC name is diethyl 3-methyl-5-[[2-(5-methylthiophene-2-carbonyl)oxyacetyl]amino]thiophene-2,4-dicarboxylate.
| Compound Name | diethyl 3-methyl-5-[[2-(5-methylthiophene-2-carbonyl)oxyacetyl]amino]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 3984044 |
| Molecular Formula | C19H21NO7S2 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | diethyl 3-methyl-5-[[2-(5-methylthiophene-2-carbonyl)oxyacetyl]amino]thiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)COC(=O)c2ccc(C)s2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C19H21NO7S2/c1-5-25-18(23)14-11(4)15(19(24)26-6-2)29-16(14)20-13(21)9-27-17(22)12-8-7-10(3)28-12/h7-8H,5-6,9H2,1-4H3,(H,20,21) |
| InChIKey | QJQSRHNILWSYTH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|