C20H21NO8S — CID 2629623
diethyl 5-[[2-(2-hydroxybenzoyl)oxyacetyl]amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 2629623) has the molecular formula C20H21NO8S and a molecular weight of 435.45 g/mol. Its IUPAC name is diethyl 5-[[2-(2-hydroxybenzoyl)oxyacetyl]amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-[[2-(2-hydroxybenzoyl)oxyacetyl]amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 2629623 |
| Molecular Formula | C20H21NO8S |
| Molecular Weight | 435.45 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | diethyl 5-[[2-(2-hydroxybenzoyl)oxyacetyl]amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)COC(=O)c2ccccc2O)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C20H21NO8S/c1-4-27-19(25)15-11(3)16(20(26)28-5-2)30-17(15)21-14(23)10-29-18(24)12-8-6-7-9-13(12)22/h6-9,22H,4-5,10H2,1-3H3,(H,21,23) |
| InChIKey | BJZNYQNLZMVJSV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|