C12H15ClN2O5S — CID 2393517
2-methoxyethyl 5-carbamoyl-2-[(2-chloroacetyl)amino]-4-methylthiophene-3-carboxylate (PubChem CID 2393517) has the molecular formula C12H15ClN2O5S and a molecular weight of 334.78 g/mol. Its IUPAC name is 2-methoxyethyl 5-carbamoyl-2-[(2-chloroacetyl)amino]-4-methylthiophene-3-carboxylate.
| Compound Name | 2-methoxyethyl 5-carbamoyl-2-[(2-chloroacetyl)amino]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 2393517 |
| Molecular Formula | C12H15ClN2O5S |
| Molecular Weight | 334.78 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 2-methoxyethyl 5-carbamoyl-2-[(2-chloroacetyl)amino]-4-methylthiophene-3-carboxylate |
| SMILES | COCCOC(=O)c1c(NC(=O)CCl)sc(C(N)=O)c1C |
| InChI | InChI=1S/C12H15ClN2O5S/c1-6-8(12(18)20-4-3-19-2)11(15-7(16)5-13)21-9(6)10(14)17/h3-5H2,1-2H3,(H2,14,17)(H,15,16) |
| InChIKey | YZWPVMPFVKZUJB-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.78 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|