C24H32N4O5S — CID 16618286
2-methoxyethyl 2-[[2-(4-benzyl-1,4-diazepan-1-yl)acetyl]amino]-5-carbamoyl-4-methylthiophene-3-carboxylate (PubChem CID 16618286) has the molecular formula C24H32N4O5S and a molecular weight of 488.61 g/mol. Its IUPAC name is 2-methoxyethyl 2-[[2-(4-benzyl-1,4-diazepan-1-yl)acetyl]amino]-5-carbamoyl-4-methylthiophene-3-carboxylate.
| Compound Name | 2-methoxyethyl 2-[[2-(4-benzyl-1,4-diazepan-1-yl)acetyl]amino]-5-carbamoyl-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 16618286 |
| Molecular Formula | C24H32N4O5S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 2-methoxyethyl 2-[[2-(4-benzyl-1,4-diazepan-1-yl)acetyl]amino]-5-carbamoyl-4-methylthiophene-3-carboxylate |
| SMILES | COCCOC(=O)c1c(NC(=O)CN2CCCN(Cc3ccccc3)CC2)sc(C(N)=O)c1C |
| InChI | InChI=1S/C24H32N4O5S/c1-17-20(24(31)33-14-13-32-2)23(34-21(17)22(25)30)26-19(29)16-28-10-6-9-27(11-12-28)15-18-7-4-3-5-8-18/h3-5,7-8H,6,9-16H2,1-2H3,(H2,25,30)(H,26,29) |
| InChIKey | JBFXPLFDNBLAOB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 114.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|