C25H31NO6S — CID 28694410
2-O-cyclohexyl 4-O-ethyl 3-methyl-5-(4-phenoxybutanoylamino)thiophene-2,4-dicarboxylate (PubChem CID 28694410) has the molecular formula C25H31NO6S and a molecular weight of 473.59 g/mol. Its IUPAC name is 2-O-cyclohexyl 4-O-ethyl 3-methyl-5-(4-phenoxybutanoylamino)thiophene-2,4-dicarboxylate.
| Compound Name | 2-O-cyclohexyl 4-O-ethyl 3-methyl-5-(4-phenoxybutanoylamino)thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 28694410 |
| Molecular Formula | C25H31NO6S |
| Molecular Weight | 473.59 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 2-O-cyclohexyl 4-O-ethyl 3-methyl-5-(4-phenoxybutanoylamino)thiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CCCOc2ccccc2)sc(C(=O)OC2CCCCC2)c1C |
| InChI | InChI=1S/C25H31NO6S/c1-3-30-24(28)21-17(2)22(25(29)32-19-13-8-5-9-14-19)33-23(21)26-20(27)15-10-16-31-18-11-6-4-7-12-18/h4,6-7,11-12,19H,3,5,8-10,13-16H2,1-2H3,(H,26,27) |
| InChIKey | FRSUCLNDYJPITR-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.59 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|