C25H33NO6S — CID 19191468
4-O-ethyl 2-O-propan-2-yl 3-methyl-5-[4-(4-propylphenoxy)butanoylamino]thiophene-2,4-dicarboxylate (PubChem CID 19191468) has the molecular formula C25H33NO6S and a molecular weight of 475.61 g/mol. Its IUPAC name is 4-O-ethyl 2-O-propan-2-yl 3-methyl-5-[4-(4-propylphenoxy)butanoylamino]thiophene-2,4-dicarboxylate.
| Compound Name | 4-O-ethyl 2-O-propan-2-yl 3-methyl-5-[4-(4-propylphenoxy)butanoylamino]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 19191468 |
| Molecular Formula | C25H33NO6S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 4-O-ethyl 2-O-propan-2-yl 3-methyl-5-[4-(4-propylphenoxy)butanoylamino]thiophene-2,4-dicarboxylate |
| SMILES | CCCc1ccc(OCCCC(=O)Nc2sc(C(=O)OC(C)C)c(C)c2C(=O)OCC)cc1 |
| InChI | InChI=1S/C25H33NO6S/c1-6-9-18-11-13-19(14-12-18)31-15-8-10-20(27)26-23-21(24(28)30-7-2)17(5)22(33-23)25(29)32-16(3)4/h11-14,16H,6-10,15H2,1-5H3,(H,26,27) |
| InChIKey | ZPZRCLUKRCUWIL-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|