C26H35NO7S — CID 19236940
diethyl 5-[3-(4-butoxy-3-ethoxyphenyl)propanoylamino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 19236940) has the molecular formula C26H35NO7S and a molecular weight of 505.63 g/mol. Its IUPAC name is diethyl 5-[3-(4-butoxy-3-ethoxyphenyl)propanoylamino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-[3-(4-butoxy-3-ethoxyphenyl)propanoylamino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 19236940 |
| Molecular Formula | C26H35NO7S |
| Molecular Weight | 505.63 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | diethyl 5-[3-(4-butoxy-3-ethoxyphenyl)propanoylamino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCCCOc1ccc(CCC(=O)Nc2sc(C(=O)OCC)c(C)c2C(=O)OCC)cc1OCC |
| InChI | InChI=1S/C26H35NO7S/c1-6-10-15-34-19-13-11-18(16-20(19)31-7-2)12-14-21(28)27-24-22(25(29)32-8-3)17(5)23(35-24)26(30)33-9-4/h11,13,16H,6-10,12,14-15H2,1-5H3,(H,27,28) |
| InChIKey | PPIDPAADMIWLBM-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.63 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|