C20H23NO7S — CID 28694141
dimethyl 5-[4-(4-methoxyphenoxy)butanoylamino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 28694141) has the molecular formula C20H23NO7S and a molecular weight of 421.47 g/mol. Its IUPAC name is dimethyl 5-[4-(4-methoxyphenoxy)butanoylamino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 5-[4-(4-methoxyphenoxy)butanoylamino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 28694141 |
| Molecular Formula | C20H23NO7S |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | dimethyl 5-[4-(4-methoxyphenoxy)butanoylamino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | COC(=O)c1sc(NC(=O)CCCOc2ccc(OC)cc2)c(C(=O)OC)c1C |
| InChI | InChI=1S/C20H23NO7S/c1-12-16(19(23)26-3)18(29-17(12)20(24)27-4)21-15(22)6-5-11-28-14-9-7-13(25-2)8-10-14/h7-10H,5-6,11H2,1-4H3,(H,21,22) |
| InChIKey | USCLOULMUOFZMO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|