C24H31NO6S — CID 19184119
4-O-ethyl 2-O-propan-2-yl 5-[4-(2,4-dimethylphenoxy)butanoylamino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 19184119) has the molecular formula C24H31NO6S and a molecular weight of 461.58 g/mol. Its IUPAC name is 4-O-ethyl 2-O-propan-2-yl 5-[4-(2,4-dimethylphenoxy)butanoylamino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | 4-O-ethyl 2-O-propan-2-yl 5-[4-(2,4-dimethylphenoxy)butanoylamino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 19184119 |
| Molecular Formula | C24H31NO6S |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 4-O-ethyl 2-O-propan-2-yl 5-[4-(2,4-dimethylphenoxy)butanoylamino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CCCOc2ccc(C)cc2C)sc(C(=O)OC(C)C)c1C |
| InChI | InChI=1S/C24H31NO6S/c1-7-29-23(27)20-17(6)21(24(28)31-14(2)3)32-22(20)25-19(26)9-8-12-30-18-11-10-15(4)13-16(18)5/h10-11,13-14H,7-9,12H2,1-6H3,(H,25,26) |
| InChIKey | INTRRWKCIXKMJB-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|