C20H21Cl2NO5S — CID 3641317
ethyl 5-acetyl-2-[4-(2,4-dichlorophenoxy)butanoylamino]-4-methylthiophene-3-carboxylate (PubChem CID 3641317) has the molecular formula C20H21Cl2NO5S and a molecular weight of 458.36 g/mol. Its IUPAC name is ethyl 5-acetyl-2-[4-(2,4-dichlorophenoxy)butanoylamino]-4-methylthiophene-3-carboxylate.
| Compound Name | ethyl 5-acetyl-2-[4-(2,4-dichlorophenoxy)butanoylamino]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 3641317 |
| Molecular Formula | C20H21Cl2NO5S |
| Molecular Weight | 458.36 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | ethyl 5-acetyl-2-[4-(2,4-dichlorophenoxy)butanoylamino]-4-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CCCOc2ccc(Cl)cc2Cl)sc(C(C)=O)c1C |
| InChI | InChI=1S/C20H21Cl2NO5S/c1-4-27-20(26)17-11(2)18(12(3)24)29-19(17)23-16(25)6-5-9-28-15-8-7-13(21)10-14(15)22/h7-8,10H,4-6,9H2,1-3H3,(H,23,25) |
| InChIKey | RVIBFCGSDOVDHW-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.36 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|