C26H26Cl2N2O5S — CID 17064156
methyl 2-[4-(2,4-dichlorophenoxy)butanoylamino]-4-methyl-5-(2-phenylethylcarbamoyl)thiophene-3-carboxylate (PubChem CID 17064156) has the molecular formula C26H26Cl2N2O5S and a molecular weight of 549.48 g/mol. Its IUPAC name is methyl 2-[4-(2,4-dichlorophenoxy)butanoylamino]-4-methyl-5-(2-phenylethylcarbamoyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[4-(2,4-dichlorophenoxy)butanoylamino]-4-methyl-5-(2-phenylethylcarbamoyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 17064156 |
| Molecular Formula | C26H26Cl2N2O5S |
| Molecular Weight | 549.48 g/mol |
| Exact Mass | 548.09 |
| IUPAC Name | methyl 2-[4-(2,4-dichlorophenoxy)butanoylamino]-4-methyl-5-(2-phenylethylcarbamoyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)CCCOc2ccc(Cl)cc2Cl)sc(C(=O)NCCc2ccccc2)c1C |
| InChI | InChI=1S/C26H26Cl2N2O5S/c1-16-22(26(33)34-2)25(36-23(16)24(32)29-13-12-17-7-4-3-5-8-17)30-21(31)9-6-14-35-20-11-10-18(27)15-19(20)28/h3-5,7-8,10-11,15H,6,9,12-14H2,1-2H3,(H,29,32)(H,30,31) |
| InChIKey | IWRVJQWOSNAPBR-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.48 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|