C17H16Cl2N2O2S — CID 2171070
N-(3-cyano-4,5-dimethylthiophen-2-yl)-4-(2,4-dichlorophenoxy)butanamide (PubChem CID 2171070) has the molecular formula C17H16Cl2N2O2S and a molecular weight of 383.30 g/mol. Its IUPAC name is N-(3-cyano-4,5-dimethylthiophen-2-yl)-4-(2,4-dichlorophenoxy)butanamide.
| Compound Name | N-(3-cyano-4,5-dimethylthiophen-2-yl)-4-(2,4-dichlorophenoxy)butanamide |
|---|---|
| PubChem CID | 2171070 |
| Molecular Formula | C17H16Cl2N2O2S |
| Molecular Weight | 383.30 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | N-(3-cyano-4,5-dimethylthiophen-2-yl)-4-(2,4-dichlorophenoxy)butanamide |
| SMILES | Cc1sc(NC(=O)CCCOc2ccc(Cl)cc2Cl)c(C#N)c1C |
| InChI | InChI=1S/C17H16Cl2N2O2S/c1-10-11(2)24-17(13(10)9-20)21-16(22)4-3-7-23-15-6-5-12(18)8-14(15)19/h5-6,8H,3-4,7H2,1-2H3,(H,21,22) |
| InChIKey | PDTVHNAPHCHNDL-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.30 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|