About 5-[[3-cyano-4-(2,4-dichlorophenyl)-5-methylthiophen-2-yl]amino]-5-oxopentanoic acid
5-[[3-cyano-4-(2,4-dichlorophenyl)-5-methylthiophen-2-yl]amino]-5-oxopentanoic acid (PubChem CID 3357191) has the molecular formula C17H14Cl2N2O3S
and a molecular weight of 397.28 g/mol. Its IUPAC name is 5-[[3-cyano-4-(2,4-dichlorophenyl)-5-methylthiophen-2-yl]amino]-5-oxopentanoic acid.
Molecular Properties
| Compound Name | 5-[[3-cyano-4-(2,4-dichlorophenyl)-5-methylthiophen-2-yl]amino]-5-oxopentanoic acid |
| PubChem CID | 3357191 |
| Molecular Formula | C17H14Cl2N2O3S |
| Molecular Weight | 397.28 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | 5-[[3-cyano-4-(2,4-dichlorophenyl)-5-methylthiophen-2-yl]amino]-5-oxopentanoic acid |
| SMILES | Cc1sc(NC(=O)CCCC(=O)O)c(C#N)c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H14Cl2N2O3S/c1-9-16(11-6-5-10(18)7-13(11)19)12(8-20)17(25-9)21-14(22)3-2-4-15(23)24/h5-7H,2-4H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | LTXYCEFOVCCJQL-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.28 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[[3-cyano-4-(2,4-dichlorophenyl)-5-methylthiophen-2-yl]amino]-5-oxopentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[3-cyano-4-(2,4-dichlorophenyl)-5-methylthiophen-2-yl]amino]-5-oxopentanoic acid?
The IUPAC name of 5-[[3-cyano-4-(2,4-dichlorophenyl)-5-methylthiophen-2-yl]amino]-5-oxopentanoic acid (CID 3357191) is 5-[[3-cyano-4-(2,4-dichlorophenyl)-5-methylthiophen-2-yl]amino]-5-oxopentanoic acid.
What is the SMILES notation for 5-[[3-cyano-4-(2,4-dichlorophenyl)-5-methylthiophen-2-yl]amino]-5-oxopentanoic acid?
The canonical SMILES for 5-[[3-cyano-4-(2,4-dichlorophenyl)-5-methylthiophen-2-yl]amino]-5-oxopentanoic acid is Cc1sc(NC(=O)CCCC(=O)O)c(C#N)c1-c1ccc(Cl)cc1Cl.
What is the InChIKey of 5-[[3-cyano-4-(2,4-dichlorophenyl)-5-methylthiophen-2-yl]amino]-5-oxopentanoic acid?
The InChIKey is LTXYCEFOVCCJQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14Cl2N2O3S/c1-9-16(11-6-5-10(18)7-13(11)19)12(8-20)17(25-9)21-14(22)3-2-4-15(23)24/h5-7H,2-4H2,1H3,(H,21,22)(H,23,24).
What are the key properties of 5-[[3-cyano-4-(2,4-dichlorophenyl)-5-methylthiophen-2-yl]amino]-5-oxopentanoic acid?
5-[[3-cyano-4-(2,4-dichlorophenyl)-5-methylthiophen-2-yl]amino]-5-oxopentanoic acid has a molecular weight of 397.28 g/mol, XLogP of 5.10, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[3-cyano-4-(2,4-dichlorophenyl)-5-methylthiophen-2-yl]amino]-5-oxopentanoic acid is sourced from PubChem (CID 3357191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).