C15H12Cl2N2O2S — CID 2970423
N-(3-cyanothiophen-2-yl)-4-(2,4-dichlorophenoxy)butanamide (PubChem CID 2970423) has the molecular formula C15H12Cl2N2O2S and a molecular weight of 355.25 g/mol. Its IUPAC name is N-(3-cyanothiophen-2-yl)-4-(2,4-dichlorophenoxy)butanamide.
| Compound Name | N-(3-cyanothiophen-2-yl)-4-(2,4-dichlorophenoxy)butanamide |
|---|---|
| PubChem CID | 2970423 |
| Molecular Formula | C15H12Cl2N2O2S |
| Molecular Weight | 355.25 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | N-(3-cyanothiophen-2-yl)-4-(2,4-dichlorophenoxy)butanamide |
| SMILES | N#Cc1ccsc1NC(=O)CCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H12Cl2N2O2S/c16-11-3-4-13(12(17)8-11)21-6-1-2-14(20)19-15-10(9-18)5-7-22-15/h3-5,7-8H,1-2,6H2,(H,19,20) |
| InChIKey | BENYZKAQZDLHOC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.25 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|