C24H28Cl2N2O2S — CID 5116893
N-[3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-(2,4-dichlorophenoxy)butanamide (PubChem CID 5116893) has the molecular formula C24H28Cl2N2O2S and a molecular weight of 479.47 g/mol. Its IUPAC name is N-[3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-(2,4-dichlorophenoxy)butanamide.
| Compound Name | N-[3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-(2,4-dichlorophenoxy)butanamide |
|---|---|
| PubChem CID | 5116893 |
| Molecular Formula | C24H28Cl2N2O2S |
| Molecular Weight | 479.47 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | N-[3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-(2,4-dichlorophenoxy)butanamide |
| SMILES | CCC(C)(C)C1CCc2c(sc(NC(=O)CCCOc3ccc(Cl)cc3Cl)c2C#N)C1 |
| InChI | InChI=1S/C24H28Cl2N2O2S/c1-4-24(2,3)15-7-9-17-18(14-27)23(31-21(17)12-15)28-22(29)6-5-11-30-20-10-8-16(25)13-19(20)26/h8,10,13,15H,4-7,9,11-12H2,1-3H3,(H,28,29) |
| InChIKey | QRPBJBRFJWHRIZ-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.47 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|