C14H10ClFN2OS — CID 18089620
5-chloro-N-(3-cyano-4,5-dimethylthiophen-2-yl)-2-fluorobenzamide (PubChem CID 18089620) has the molecular formula C14H10ClFN2OS and a molecular weight of 308.77 g/mol. Its IUPAC name is 5-chloro-N-(3-cyano-4,5-dimethylthiophen-2-yl)-2-fluorobenzamide.
| Compound Name | 5-chloro-N-(3-cyano-4,5-dimethylthiophen-2-yl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 18089620 |
| Molecular Formula | C14H10ClFN2OS |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 5-chloro-N-(3-cyano-4,5-dimethylthiophen-2-yl)-2-fluorobenzamide |
| SMILES | Cc1sc(NC(=O)c2cc(Cl)ccc2F)c(C#N)c1C |
| InChI | InChI=1S/C14H10ClFN2OS/c1-7-8(2)20-14(11(7)6-17)18-13(19)10-5-9(15)3-4-12(10)16/h3-5H,1-2H3,(H,18,19) |
| InChIKey | FGRNUJGFNAHKNS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |