C16H13N3OS — CID 43981400
N-(3-cyano-4,5-dimethylthiophen-2-yl)-1H-indole-3-carboxamide (PubChem CID 43981400) has the molecular formula C16H13N3OS and a molecular weight of 295.37 g/mol. Its IUPAC name is N-(3-cyano-4,5-dimethylthiophen-2-yl)-1H-indole-3-carboxamide.
| Compound Name | N-(3-cyano-4,5-dimethylthiophen-2-yl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 43981400 |
| Molecular Formula | C16H13N3OS |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | N-(3-cyano-4,5-dimethylthiophen-2-yl)-1H-indole-3-carboxamide |
| SMILES | Cc1sc(NC(=O)c2c[nH]c3ccccc23)c(C#N)c1C |
| InChI | InChI=1S/C16H13N3OS/c1-9-10(2)21-16(12(9)7-17)19-15(20)13-8-18-14-6-4-3-5-11(13)14/h3-6,8,18H,1-2H3,(H,19,20) |
| InChIKey | RVQNYDFDRUJJGL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |