C17H18N2O3S2 — CID 75403159
N-(3-cyano-4,5-dimethylthiophen-2-yl)-2-propan-2-ylsulfonylbenzamide (PubChem CID 75403159) has the molecular formula C17H18N2O3S2 and a molecular weight of 362.48 g/mol. Its IUPAC name is N-(3-cyano-4,5-dimethylthiophen-2-yl)-2-propan-2-ylsulfonylbenzamide.
| Compound Name | N-(3-cyano-4,5-dimethylthiophen-2-yl)-2-propan-2-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 75403159 |
| Molecular Formula | C17H18N2O3S2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | N-(3-cyano-4,5-dimethylthiophen-2-yl)-2-propan-2-ylsulfonylbenzamide |
| SMILES | Cc1sc(NC(=O)c2ccccc2S(=O)(=O)C(C)C)c(C#N)c1C |
| InChI | InChI=1S/C17H18N2O3S2/c1-10(2)24(21,22)15-8-6-5-7-13(15)16(20)19-17-14(9-18)11(3)12(4)23-17/h5-8,10H,1-4H3,(H,19,20) |
| InChIKey | NLPRWTAEKVROJS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |