C15H13N3OS2 — CID 899430
N-[(3-cyano-4,5-dimethylthiophen-2-yl)carbamothioyl]benzamide (PubChem CID 899430) has the molecular formula C15H13N3OS2 and a molecular weight of 315.42 g/mol. Its IUPAC name is N-[(3-cyano-4,5-dimethylthiophen-2-yl)carbamothioyl]benzamide.
| Compound Name | N-[(3-cyano-4,5-dimethylthiophen-2-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 899430 |
| Molecular Formula | C15H13N3OS2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | N-[(3-cyano-4,5-dimethylthiophen-2-yl)carbamothioyl]benzamide |
| SMILES | Cc1sc(NC(=S)NC(=O)c2ccccc2)c(C#N)c1C |
| InChI | InChI=1S/C15H13N3OS2/c1-9-10(2)21-14(12(9)8-16)18-15(20)17-13(19)11-6-4-3-5-7-11/h3-7H,1-2H3,(H2,17,18,19,20) |
| InChIKey | ZTHSZRWHXPFGAR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|