C19H19N5O3S2 — CID 22779082
N-[(3-cyano-4,5-dimethylthiophen-2-yl)carbamothioyl]-3-nitro-4-pyrrolidin-1-ylbenzamide (PubChem CID 22779082) has the molecular formula C19H19N5O3S2 and a molecular weight of 429.53 g/mol. Its IUPAC name is N-[(3-cyano-4,5-dimethylthiophen-2-yl)carbamothioyl]-3-nitro-4-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[(3-cyano-4,5-dimethylthiophen-2-yl)carbamothioyl]-3-nitro-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 22779082 |
| Molecular Formula | C19H19N5O3S2 |
| Molecular Weight | 429.53 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | N-[(3-cyano-4,5-dimethylthiophen-2-yl)carbamothioyl]-3-nitro-4-pyrrolidin-1-ylbenzamide |
| SMILES | Cc1sc(NC(=S)NC(=O)c2ccc(N3CCCC3)c([N+](=O)[O-])c2)c(C#N)c1C |
| InChI | InChI=1S/C19H19N5O3S2/c1-11-12(2)29-18(14(11)10-20)22-19(28)21-17(25)13-5-6-15(16(9-13)24(26)27)23-7-3-4-8-23/h5-6,9H,3-4,7-8H2,1-2H3,(H2,21,22,25,28) |
| InChIKey | TVTIJRVFAHWMCA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 111.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.53 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|