C18H19N5O5S2 — CID 17103774
methyl 4-methyl-2-[(3-nitro-4-pyrrolidin-1-ylbenzoyl)carbamothioylamino]-1,3-thiazole-5-carboxylate (PubChem CID 17103774) has the molecular formula C18H19N5O5S2 and a molecular weight of 449.51 g/mol. Its IUPAC name is methyl 4-methyl-2-[(3-nitro-4-pyrrolidin-1-ylbenzoyl)carbamothioylamino]-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 4-methyl-2-[(3-nitro-4-pyrrolidin-1-ylbenzoyl)carbamothioylamino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 17103774 |
| Molecular Formula | C18H19N5O5S2 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | methyl 4-methyl-2-[(3-nitro-4-pyrrolidin-1-ylbenzoyl)carbamothioylamino]-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(NC(=S)NC(=O)c2ccc(N3CCCC3)c([N+](=O)[O-])c2)nc1C |
| InChI | InChI=1S/C18H19N5O5S2/c1-10-14(16(25)28-2)30-18(19-10)21-17(29)20-15(24)11-5-6-12(13(9-11)23(26)27)22-7-3-4-8-22/h5-6,9H,3-4,7-8H2,1-2H3,(H2,19,20,21,24,29) |
| InChIKey | OMEAERGNKCOHIJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 126.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|