C14H11Cl2N3OS — CID 82812379
4-amino-3,5-dichloro-N-(3-cyano-4,5-dimethylthiophen-2-yl)benzamide (PubChem CID 82812379) has the molecular formula C14H11Cl2N3OS and a molecular weight of 340.24 g/mol. Its IUPAC name is 4-amino-3,5-dichloro-N-(3-cyano-4,5-dimethylthiophen-2-yl)benzamide.
| Compound Name | 4-amino-3,5-dichloro-N-(3-cyano-4,5-dimethylthiophen-2-yl)benzamide |
|---|---|
| PubChem CID | 82812379 |
| Molecular Formula | C14H11Cl2N3OS |
| Molecular Weight | 340.24 g/mol |
| Exact Mass | 339.00 |
| IUPAC Name | 4-amino-3,5-dichloro-N-(3-cyano-4,5-dimethylthiophen-2-yl)benzamide |
| SMILES | Cc1sc(NC(=O)c2cc(Cl)c(N)c(Cl)c2)c(C#N)c1C |
| InChI | InChI=1S/C14H11Cl2N3OS/c1-6-7(2)21-14(9(6)5-17)19-13(20)8-3-10(15)12(18)11(16)4-8/h3-4H,18H2,1-2H3,(H,19,20) |
| InChIKey | XENPYTROJQSVTA-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.24 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|