C23H21ClN2O2S — CID 4172635
4-(4-chloro-2-methylphenoxy)-N-(3-cyano-5-methyl-4-phenylthiophen-2-yl)butanamide (PubChem CID 4172635) has the molecular formula C23H21ClN2O2S and a molecular weight of 424.95 g/mol. Its IUPAC name is 4-(4-chloro-2-methylphenoxy)-N-(3-cyano-5-methyl-4-phenylthiophen-2-yl)butanamide.
| Compound Name | 4-(4-chloro-2-methylphenoxy)-N-(3-cyano-5-methyl-4-phenylthiophen-2-yl)butanamide |
|---|---|
| PubChem CID | 4172635 |
| Molecular Formula | C23H21ClN2O2S |
| Molecular Weight | 424.95 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 4-(4-chloro-2-methylphenoxy)-N-(3-cyano-5-methyl-4-phenylthiophen-2-yl)butanamide |
| SMILES | Cc1cc(Cl)ccc1OCCCC(=O)Nc1sc(C)c(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C23H21ClN2O2S/c1-15-13-18(24)10-11-20(15)28-12-6-9-21(27)26-23-19(14-25)22(16(2)29-23)17-7-4-3-5-8-17/h3-5,7-8,10-11,13H,6,9,12H2,1-2H3,(H,26,27) |
| InChIKey | SRBGPWBYVYXXPY-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.95 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|