C18H20ClN3O4S — CID 154757997
N-[5-[[4-(4-chloro-2-methylphenoxy)butanoylamino]carbamoyl]thiophen-2-yl]acetamide (PubChem CID 154757997) has the molecular formula C18H20ClN3O4S and a molecular weight of 409.90 g/mol. Its IUPAC name is N-[5-[[4-(4-chloro-2-methylphenoxy)butanoylamino]carbamoyl]thiophen-2-yl]acetamide.
| Compound Name | N-[5-[[4-(4-chloro-2-methylphenoxy)butanoylamino]carbamoyl]thiophen-2-yl]acetamide |
|---|---|
| PubChem CID | 154757997 |
| Molecular Formula | C18H20ClN3O4S |
| Molecular Weight | 409.90 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | N-[5-[[4-(4-chloro-2-methylphenoxy)butanoylamino]carbamoyl]thiophen-2-yl]acetamide |
| SMILES | CC(=O)Nc1ccc(C(=O)NNC(=O)CCCOc2ccc(Cl)cc2C)s1 |
| InChI | InChI=1S/C18H20ClN3O4S/c1-11-10-13(19)5-6-14(11)26-9-3-4-16(24)21-22-18(25)15-7-8-17(27-15)20-12(2)23/h5-8,10H,3-4,9H2,1-2H3,(H,20,23)(H,21,24)(H,22,25) |
| InChIKey | DDZWZSXFAWZMNU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.90 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|