C19H21Cl2N3O2S — CID 17371463
1-[4-(4-chloro-2-methylphenoxy)butanoylamino]-3-(5-chloro-2-methylphenyl)thiourea (PubChem CID 17371463) has the molecular formula C19H21Cl2N3O2S and a molecular weight of 426.37 g/mol. Its IUPAC name is 1-[4-(4-chloro-2-methylphenoxy)butanoylamino]-3-(5-chloro-2-methylphenyl)thiourea.
| Compound Name | 1-[4-(4-chloro-2-methylphenoxy)butanoylamino]-3-(5-chloro-2-methylphenyl)thiourea |
|---|---|
| PubChem CID | 17371463 |
| Molecular Formula | C19H21Cl2N3O2S |
| Molecular Weight | 426.37 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | 1-[4-(4-chloro-2-methylphenoxy)butanoylamino]-3-(5-chloro-2-methylphenyl)thiourea |
| SMILES | Cc1ccc(Cl)cc1NC(=S)NNC(=O)CCCOc1ccc(Cl)cc1C |
| InChI | InChI=1S/C19H21Cl2N3O2S/c1-12-5-6-15(21)11-16(12)22-19(27)24-23-18(25)4-3-9-26-17-8-7-14(20)10-13(17)2/h5-8,10-11H,3-4,9H2,1-2H3,(H,23,25)(H2,22,24,27) |
| InChIKey | TVMSNOZULDVIMP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.37 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|