C16H19ClN4O3S — CID 30544540
N'-[4-(4-chloro-2-methylphenoxy)butanoyl]-4-ethylthiadiazole-5-carbohydrazide (PubChem CID 30544540) has the molecular formula C16H19ClN4O3S and a molecular weight of 382.87 g/mol. Its IUPAC name is N'-[4-(4-chloro-2-methylphenoxy)butanoyl]-4-ethylthiadiazole-5-carbohydrazide.
| Compound Name | N'-[4-(4-chloro-2-methylphenoxy)butanoyl]-4-ethylthiadiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 30544540 |
| Molecular Formula | C16H19ClN4O3S |
| Molecular Weight | 382.87 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | N'-[4-(4-chloro-2-methylphenoxy)butanoyl]-4-ethylthiadiazole-5-carbohydrazide |
| SMILES | CCc1nnsc1C(=O)NNC(=O)CCCOc1ccc(Cl)cc1C |
| InChI | InChI=1S/C16H19ClN4O3S/c1-3-12-15(25-21-18-12)16(23)20-19-14(22)5-4-8-24-13-7-6-11(17)9-10(13)2/h6-7,9H,3-5,8H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | KXGUTNYAGOVOQY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.87 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|