C21H24Cl2N2O5S — CID 17063846
methyl 2-[4-(2,4-dichlorophenoxy)butanoylamino]-4-methyl-5-(propan-2-ylcarbamoyl)thiophene-3-carboxylate (PubChem CID 17063846) has the molecular formula C21H24Cl2N2O5S and a molecular weight of 487.41 g/mol. Its IUPAC name is methyl 2-[4-(2,4-dichlorophenoxy)butanoylamino]-4-methyl-5-(propan-2-ylcarbamoyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[4-(2,4-dichlorophenoxy)butanoylamino]-4-methyl-5-(propan-2-ylcarbamoyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 17063846 |
| Molecular Formula | C21H24Cl2N2O5S |
| Molecular Weight | 487.41 g/mol |
| Exact Mass | 486.08 |
| IUPAC Name | methyl 2-[4-(2,4-dichlorophenoxy)butanoylamino]-4-methyl-5-(propan-2-ylcarbamoyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)CCCOc2ccc(Cl)cc2Cl)sc(C(=O)NC(C)C)c1C |
| InChI | InChI=1S/C21H24Cl2N2O5S/c1-11(2)24-19(27)18-12(3)17(21(28)29-4)20(31-18)25-16(26)6-5-9-30-15-8-7-13(22)10-14(15)23/h7-8,10-11H,5-6,9H2,1-4H3,(H,24,27)(H,25,26) |
| InChIKey | NMUZWYWFOJZFGZ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.41 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|