C24H20Cl4N2O5S — CID 17064937
methyl 2-[4-(2,4-dichlorophenoxy)butanoylamino]-5-[(2,5-dichlorophenyl)carbamoyl]-4-methylthiophene-3-carboxylate (PubChem CID 17064937) has the molecular formula C24H20Cl4N2O5S and a molecular weight of 590.31 g/mol. Its IUPAC name is methyl 2-[4-(2,4-dichlorophenoxy)butanoylamino]-5-[(2,5-dichlorophenyl)carbamoyl]-4-methylthiophene-3-carboxylate.
| Compound Name | methyl 2-[4-(2,4-dichlorophenoxy)butanoylamino]-5-[(2,5-dichlorophenyl)carbamoyl]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 17064937 |
| Molecular Formula | C24H20Cl4N2O5S |
| Molecular Weight | 590.31 g/mol |
| Exact Mass | 587.98 |
| IUPAC Name | methyl 2-[4-(2,4-dichlorophenoxy)butanoylamino]-5-[(2,5-dichlorophenyl)carbamoyl]-4-methylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)CCCOc2ccc(Cl)cc2Cl)sc(C(=O)Nc2cc(Cl)ccc2Cl)c1C |
| InChI | InChI=1S/C24H20Cl4N2O5S/c1-12-20(24(33)34-2)23(36-21(12)22(32)29-17-11-14(26)5-7-15(17)27)30-19(31)4-3-9-35-18-8-6-13(25)10-16(18)28/h5-8,10-11H,3-4,9H2,1-2H3,(H,29,32)(H,30,31) |
| InChIKey | ZEZVJQXIYPIMLP-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.31 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|