C16H16Cl2N2O4S — CID 55333613
ethyl 2-[4-(2,4-dichlorophenoxy)butanoylamino]-1,3-thiazole-4-carboxylate (PubChem CID 55333613) has the molecular formula C16H16Cl2N2O4S and a molecular weight of 403.29 g/mol. Its IUPAC name is ethyl 2-[4-(2,4-dichlorophenoxy)butanoylamino]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[4-(2,4-dichlorophenoxy)butanoylamino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 55333613 |
| Molecular Formula | C16H16Cl2N2O4S |
| Molecular Weight | 403.29 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | ethyl 2-[4-(2,4-dichlorophenoxy)butanoylamino]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(NC(=O)CCCOc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C16H16Cl2N2O4S/c1-2-23-15(22)12-9-25-16(19-12)20-14(21)4-3-7-24-13-6-5-10(17)8-11(13)18/h5-6,8-9H,2-4,7H2,1H3,(H,19,20,21) |
| InChIKey | FGEYJKYJIYOHGF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.29 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|