C21H20Cl2N2O4S — CID 19183987
4-(2,4-dichlorophenoxy)-N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]butanamide (PubChem CID 19183987) has the molecular formula C21H20Cl2N2O4S and a molecular weight of 467.37 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]butanamide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 19183987 |
| Molecular Formula | C21H20Cl2N2O4S |
| Molecular Weight | 467.37 g/mol |
| Exact Mass | 466.05 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]butanamide |
| SMILES | COc1ccc(-c2csc(NC(=O)CCCOc3ccc(Cl)cc3Cl)n2)cc1OC |
| InChI | InChI=1S/C21H20Cl2N2O4S/c1-27-18-7-5-13(10-19(18)28-2)16-12-30-21(24-16)25-20(26)4-3-9-29-17-8-6-14(22)11-15(17)23/h5-8,10-12H,3-4,9H2,1-2H3,(H,24,25,26) |
| InChIKey | WLSGQVHURLXHIB-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.37 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|