C20H19ClN2O3S — CID 19197145
4-(4-chlorophenoxy)-N-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]butanamide (PubChem CID 19197145) has the molecular formula C20H19ClN2O3S and a molecular weight of 402.90 g/mol. Its IUPAC name is 4-(4-chlorophenoxy)-N-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]butanamide.
| Compound Name | 4-(4-chlorophenoxy)-N-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 19197145 |
| Molecular Formula | C20H19ClN2O3S |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 4-(4-chlorophenoxy)-N-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]butanamide |
| SMILES | COc1cccc(-c2csc(NC(=O)CCCOc3ccc(Cl)cc3)n2)c1 |
| InChI | InChI=1S/C20H19ClN2O3S/c1-25-17-5-2-4-14(12-17)18-13-27-20(22-18)23-19(24)6-3-11-26-16-9-7-15(21)8-10-16/h2,4-5,7-10,12-13H,3,6,11H2,1H3,(H,22,23,24) |
| InChIKey | ZDOGYEPREHOPGZ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|