C24H28N2O3S — CID 19197128
4-(4-tert-butylphenoxy)-N-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]butanamide (PubChem CID 19197128) has the molecular formula C24H28N2O3S and a molecular weight of 424.57 g/mol. Its IUPAC name is 4-(4-tert-butylphenoxy)-N-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]butanamide.
| Compound Name | 4-(4-tert-butylphenoxy)-N-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 19197128 |
| Molecular Formula | C24H28N2O3S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 4-(4-tert-butylphenoxy)-N-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]butanamide |
| SMILES | COc1cccc(-c2csc(NC(=O)CCCOc3ccc(C(C)(C)C)cc3)n2)c1 |
| InChI | InChI=1S/C24H28N2O3S/c1-24(2,3)18-10-12-19(13-11-18)29-14-6-9-22(27)26-23-25-21(16-30-23)17-7-5-8-20(15-17)28-4/h5,7-8,10-13,15-16H,6,9,14H2,1-4H3,(H,25,26,27) |
| InChIKey | RNSJWGYMMOKCAG-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|